C18H29N3O4 — CID 142604137
[5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methyl 2-propylpentanoate (PubChem CID 142604137) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is [5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methyl 2-propylpentanoate.
| Compound Name | [5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methyl 2-propylpentanoate |
|---|---|
| PubChem CID | 142604137 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methyl 2-propylpentanoate |
| SMILES | C=C1N=C(NO)C=CN1C1CCC(COC(=O)C(CCC)CCC)O1 |
| InChI | InChI=1S/C18H29N3O4/c1-4-6-14(7-5-2)18(22)24-12-15-8-9-17(25-15)21-11-10-16(20-23)19-13(21)3/h10-11,14-15,17,23H,3-9,12H2,1-2H3,(H,19,20) |
| InChIKey | CTOSPBJZCYEVFX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|