About 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole
1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole (PubChem CID 142604256) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole.
Molecular Properties
| Compound Name | 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole |
| PubChem CID | 142604256 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole |
| SMILES | CC.CC(C)C(=O)CN.Cc1cnc[nH]1 |
| InChI | InChI=1S/C5H11NO.C4H6N2.C2H6/c1-4(2)5(7)3-6;1-4-2-5-3-6-4;1-2/h4H,3,6H2,1-2H3;2-3H,1H3,(H,5,6);1-2H3 |
| InChIKey | DTZPHNNPHJQZIK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole?
The IUPAC name of 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole (CID 142604256) is 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole.
What is the SMILES notation for 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole?
The canonical SMILES for 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole is CC.CC(C)C(=O)CN.Cc1cnc[nH]1.
What is the InChIKey of 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole?
The InChIKey is DTZPHNNPHJQZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C4H6N2.C2H6/c1-4(2)5(7)3-6;1-4-2-5-3-6-4;1-2/h4H,3,6H2,1-2H3;2-3H,1H3,(H,5,6);1-2H3.
What are the key properties of 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole?
1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole has a molecular weight of 213.32 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-methylbutan-2-one;ethane;5-methyl-1H-imidazole is sourced from PubChem (CID 142604256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).