C10H10N4O4 — CID 142606545
4-(2,6-dimethyl-4-nitrophenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 142606545) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-nitrophenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2,6-dimethyl-4-nitrophenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 142606545 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-(2,6-dimethyl-4-nitrophenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1-n1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C10H10N4O4/c1-5-3-7(14(17)18)4-6(2)8(5)13-9(15)11-12-10(13)16/h3-4H,1-2H3,(H,11,15)(H,12,16) |
| InChIKey | YJLSWBPSJOOVHN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|