C13H16N2O3 — CID 71300011
1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one (PubChem CID 71300011) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one.
| Compound Name | 1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one |
|---|---|
| PubChem CID | 71300011 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc([N+](=O)[O-])cc(C)c21 |
| InChI | InChI=1S/C13H16N2O3/c1-5-14-11-8(2)6-9(15(17)18)7-10(11)13(3,4)12(14)16/h6-7H,5H2,1-4H3 |
| InChIKey | AXOWQJSPUAUQKT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|