C25H29F3N6 — CID 142606860
(9R)-N-[4-(4-methylimidazol-1-yl)-1-bicyclo[2.2.2]octanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 142606860) has the molecular formula C25H29F3N6 and a molecular weight of 470.54 g/mol. Its IUPAC name is (9R)-N-[4-(4-methylimidazol-1-yl)-1-bicyclo[2.2.2]octanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | (9R)-N-[4-(4-methylimidazol-1-yl)-1-bicyclo[2.2.2]octanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 142606860 |
| Molecular Formula | C25H29F3N6 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | (9R)-N-[4-(4-methylimidazol-1-yl)-1-bicyclo[2.2.2]octanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | Cc1cn(C23CCC(Nc4nc5n(n4)CCCC[C@@H]5c4ccc(F)c(F)c4F)(CC2)CC3)cn1 |
| InChI | InChI=1S/C25H29F3N6/c1-16-14-33(15-29-16)25-10-7-24(8-11-25,9-12-25)31-23-30-22-18(4-2-3-13-34(22)32-23)17-5-6-19(26)21(28)20(17)27/h5-6,14-15,18H,2-4,7-13H2,1H3,(H,31,32)/t18-,24?,25?/m1/s1 |
| InChIKey | GCMLTSAKXNNCAR-SGAUDOEVSA-N |
| XLogP | 5.43 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|