C22H23F3N6 — CID 155624576
N-[3-(4-methylimidazol-1-yl)-1-bicyclo[1.1.1]pentanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 155624576) has the molecular formula C22H23F3N6 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[3-(4-methylimidazol-1-yl)-1-bicyclo[1.1.1]pentanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[3-(4-methylimidazol-1-yl)-1-bicyclo[1.1.1]pentanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 155624576 |
| Molecular Formula | C22H23F3N6 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[3-(4-methylimidazol-1-yl)-1-bicyclo[1.1.1]pentanyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | Cc1cn(C23CC(Nc4nc5n(n4)CCCCC5c4ccc(F)c(F)c4F)(C2)C3)cn1 |
| InChI | InChI=1S/C22H23F3N6/c1-13-8-30(12-26-13)22-9-21(10-22,11-22)28-20-27-19-15(4-2-3-7-31(19)29-20)14-5-6-16(23)18(25)17(14)24/h5-6,8,12,15H,2-4,7,9-11H2,1H3,(H,28,29) |
| InChIKey | PEMBCNFSHYYUPQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|