C14H21N — CID 142610943
ethane;4-propan-2-yl-6,7-dihydroquinoline (PubChem CID 142610943) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;4-propan-2-yl-6,7-dihydroquinoline.
| Compound Name | ethane;4-propan-2-yl-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 142610943 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;4-propan-2-yl-6,7-dihydroquinoline |
| SMILES | CC.CC(C)c1ccnc2c1=CCCC=2 |
| InChI | InChI=1S/C12H15N.C2H6/c1-9(2)10-7-8-13-12-6-4-3-5-11(10)12;1-2/h5-9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | UYEHDWCIPSQOBN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |