C33H38O8 — CID 142613029
[4-[(1E,6E)-3,5-dioxo-7-[4-(4-oxopentanoyloxy)phenyl]hepta-1,6-dienyl]phenyl] 5-methyl-4-oxohexanoate;ethane (PubChem CID 142613029) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is [4-[(1E,6E)-3,5-dioxo-7-[4-(4-oxopentanoyloxy)phenyl]hepta-1,6-dienyl]phenyl] 5-methyl-4-oxohexanoate;ethane.
| Compound Name | [4-[(1E,6E)-3,5-dioxo-7-[4-(4-oxopentanoyloxy)phenyl]hepta-1,6-dienyl]phenyl] 5-methyl-4-oxohexanoate;ethane |
|---|---|
| PubChem CID | 142613029 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [4-[(1E,6E)-3,5-dioxo-7-[4-(4-oxopentanoyloxy)phenyl]hepta-1,6-dienyl]phenyl] 5-methyl-4-oxohexanoate;ethane |
| SMILES | CC.CC(=O)CCC(=O)Oc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)CCC(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H32O8.C2H6/c1-21(2)29(35)17-19-31(37)39-28-15-9-24(10-16-28)6-12-26(34)20-25(33)11-5-23-7-13-27(14-8-23)38-30(36)18-4-22(3)32;1-2/h5-16,21H,4,17-20H2,1-3H3;1-2H3/b11-5+,12-6+; |
| InChIKey | XWEPGFHWVPILOX-JPAPVDFESA-N |
| XLogP | 6.15 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|