C29H46N2O — CID 142619027
(6Z,8Z)-5,7-diethyl-N-[1-[2-[(E)-1-methoxyprop-1-enyl]-6-methylidene-1H-pyridin-3-yl]butan-2-yl]-8-methyldeca-4,6,8-trien-1-amine (PubChem CID 142619027) has the molecular formula C29H46N2O and a molecular weight of 438.70 g/mol. Its IUPAC name is (6Z,8Z)-5,7-diethyl-N-[1-[2-[(E)-1-methoxyprop-1-enyl]-6-methylidene-1H-pyridin-3-yl]butan-2-yl]-8-methyldeca-4,6,8-trien-1-amine.
| Compound Name | (6Z,8Z)-5,7-diethyl-N-[1-[2-[(E)-1-methoxyprop-1-enyl]-6-methylidene-1H-pyridin-3-yl]butan-2-yl]-8-methyldeca-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 142619027 |
| Molecular Formula | C29H46N2O |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.36 |
| IUPAC Name | (6Z,8Z)-5,7-diethyl-N-[1-[2-[(E)-1-methoxyprop-1-enyl]-6-methylidene-1H-pyridin-3-yl]butan-2-yl]-8-methyldeca-4,6,8-trien-1-amine |
| SMILES | C=C1C=CC(CC(CC)NCCCC=C(/C=C(CC)\C(C)=C/C)CC)=C(/C(=C\C)OC)N1 |
| InChI | InChI=1S/C29H46N2O/c1-9-22(6)25(11-3)20-24(10-2)16-14-15-19-30-27(12-4)21-26-18-17-23(7)31-29(26)28(13-5)32-8/h9,13,16-18,20,27,30-31H,7,10-12,14-15,19,21H2,1-6,8H3/b22-9-,24-16?,25-20-,28-13+ |
| InChIKey | OBQBBNRKPVHRFV-OCSIGDEMSA-N |
| XLogP | 7.64 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|