C7H11NO — CID 142620628
(E)-2-(C,N-dimethylcarbonimidoyl)but-2-enal (PubChem CID 142620628) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enal.
| Compound Name | (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enal |
|---|---|
| PubChem CID | 142620628 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enal |
| SMILES | C/C=C(C=O)\C(C)=N\C |
| InChI | InChI=1S/C7H11NO/c1-4-7(5-9)6(2)8-3/h4-5H,1-3H3/b7-4-,8-6+ |
| InChIKey | WTMUZHJNOSVQNZ-ZJLRGQKUSA-N |
| XLogP | 1.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|