C31H32Cl2N6O2 — CID 142621528
6-(2,6-dichlorophenyl)-2-[4-[4-(dimethylamino)piperidin-1-yl]-3-methylanilino]-8-(3-methoxyprop-1-ynyl)pyrido[4,3-d]pyrimidin-5-one (PubChem CID 142621528) has the molecular formula C31H32Cl2N6O2 and a molecular weight of 591.54 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-[4-(dimethylamino)piperidin-1-yl]-3-methylanilino]-8-(3-methoxyprop-1-ynyl)pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-[4-(dimethylamino)piperidin-1-yl]-3-methylanilino]-8-(3-methoxyprop-1-ynyl)pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 142621528 |
| Molecular Formula | C31H32Cl2N6O2 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-[4-(dimethylamino)piperidin-1-yl]-3-methylanilino]-8-(3-methoxyprop-1-ynyl)pyrido[4,3-d]pyrimidin-5-one |
| SMILES | COCC#Cc1cn(-c2c(Cl)cccc2Cl)c(=O)c2cnc(Nc3ccc(N4CCC(N(C)C)CC4)c(C)c3)nc12 |
| InChI | InChI=1S/C31H32Cl2N6O2/c1-20-17-22(10-11-27(20)38-14-12-23(13-15-38)37(2)3)35-31-34-18-24-28(36-31)21(7-6-16-41-4)19-39(30(24)40)29-25(32)8-5-9-26(29)33/h5,8-11,17-19,23H,12-16H2,1-4H3,(H,34,35,36) |
| InChIKey | AXYWPUSGVUTYAY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|