C26H27N3O3S — CID 142629304
N-[(2S)-5-(3-aminophenyl)-1-oxo-1-piperidin-1-ylpent-4-yn-2-yl]naphthalene-2-sulfonamide (PubChem CID 142629304) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[(2S)-5-(3-aminophenyl)-1-oxo-1-piperidin-1-ylpent-4-yn-2-yl]naphthalene-2-sulfonamide.
| Compound Name | N-[(2S)-5-(3-aminophenyl)-1-oxo-1-piperidin-1-ylpent-4-yn-2-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 142629304 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[(2S)-5-(3-aminophenyl)-1-oxo-1-piperidin-1-ylpent-4-yn-2-yl]naphthalene-2-sulfonamide |
| SMILES | Nc1cccc(C#CC[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C26H27N3O3S/c27-23-12-6-8-20(18-23)9-7-13-25(26(30)29-16-4-1-5-17-29)28-33(31,32)24-15-14-21-10-2-3-11-22(21)19-24/h2-3,6,8,10-12,14-15,18-19,25,28H,1,4-5,13,16-17,27H2/t25-/m0/s1 |
| InChIKey | WWLFEDMKQQMMCE-VWLOTQADSA-N |
| XLogP | 3.52 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|