C6H8ClN3OS — CID 142632166
5-chloro-6-ethoxy-3-methylsulfanyl-1,2,4-triazine (PubChem CID 142632166) has the molecular formula C6H8ClN3OS and a molecular weight of 205.67 g/mol. Its IUPAC name is 5-chloro-6-ethoxy-3-methylsulfanyl-1,2,4-triazine.
| Compound Name | 5-chloro-6-ethoxy-3-methylsulfanyl-1,2,4-triazine |
|---|---|
| PubChem CID | 142632166 |
| Molecular Formula | C6H8ClN3OS |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 5-chloro-6-ethoxy-3-methylsulfanyl-1,2,4-triazine |
| SMILES | CCOc1nnc(SC)nc1Cl |
| InChI | InChI=1S/C6H8ClN3OS/c1-3-11-5-4(7)8-6(12-2)10-9-5/h3H2,1-2H3 |
| InChIKey | QSCXIRFQSJJILC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |