About 12-iminododecanoic acid
12-iminododecanoic acid (PubChem CID 142632270) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 12-iminododecanoic acid.
Molecular Properties
| Compound Name | 12-iminododecanoic acid |
| PubChem CID | 142632270 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 12-iminododecanoic acid |
| SMILES | [H]/N=C/CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H23NO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h11,13H,1-10H2,(H,14,15)/b13-11+ |
| InChIKey | WZGDSFDLINFELK-ACCUITESSA-N |
| XLogP | 3.62 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 12-iminododecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-iminododecanoic acid?
The IUPAC name of 12-iminododecanoic acid (CID 142632270) is 12-iminododecanoic acid.
What is the SMILES notation for 12-iminododecanoic acid?
The canonical SMILES for 12-iminododecanoic acid is [H]/N=C/CCCCCCCCCCC(=O)O.
What is the InChIKey of 12-iminododecanoic acid?
The InChIKey is WZGDSFDLINFELK-ACCUITESSA-N. The full InChI is InChI=1S/C12H23NO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h11,13H,1-10H2,(H,14,15)/b13-11+.
What are the key properties of 12-iminododecanoic acid?
12-iminododecanoic acid has a molecular weight of 213.32 g/mol, XLogP of 3.62, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-iminododecanoic acid is sourced from PubChem (CID 142632270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).