C17H26FNO — CID 142633159
N-ethyl-2-(3-fluoropropyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 142633159) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is N-ethyl-2-(3-fluoropropyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | N-ethyl-2-(3-fluoropropyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 142633159 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-ethyl-2-(3-fluoropropyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | CCNc1c(C)c(C)c2c(c1C)CC(C)(CCCF)O2 |
| InChI | InChI=1S/C17H26FNO/c1-6-19-15-11(2)12(3)16-14(13(15)4)10-17(5,20-16)8-7-9-18/h19H,6-10H2,1-5H3 |
| InChIKey | XQFDHJXUFDWOND-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|