C15H20BrNO3 — CID 22111063
[2-(2-bromoethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]carbamic acid (PubChem CID 22111063) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is [2-(2-bromoethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]carbamic acid.
| Compound Name | [2-(2-bromoethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]carbamic acid |
|---|---|
| PubChem CID | 22111063 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [2-(2-bromoethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]carbamic acid |
| SMILES | Cc1c(C)c2c(c(C)c1NC(=O)O)CC(C)(CCBr)O2 |
| InChI | InChI=1S/C15H20BrNO3/c1-8-9(2)13-11(7-15(4,20-13)5-6-16)10(3)12(8)17-14(18)19/h17H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | PGJAGVVHOQDUHN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|