C13H17NO5 — CID 142634073
methyl (1R,4aS,7aS)-7-(N-hydroxy-C-methylcarbonimidoyl)-1-methoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 142634073) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl (1R,4aS,7aS)-7-(N-hydroxy-C-methylcarbonimidoyl)-1-methoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,7aS)-7-(N-hydroxy-C-methylcarbonimidoyl)-1-methoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 142634073 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl (1R,4aS,7aS)-7-(N-hydroxy-C-methylcarbonimidoyl)-1-methoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OC)[C@@H]2C(C(C)=NO)=CC[C@H]12 |
| InChI | InChI=1S/C13H17NO5/c1-7(14-16)8-4-5-9-10(12(15)17-2)6-19-13(18-3)11(8)9/h4,6,9,11,13,16H,5H2,1-3H3/t9-,11-,13-/m1/s1 |
| InChIKey | HADKYBYTQMBUJI-IRUJWGPZSA-N |
| XLogP | 1.46 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|