C44H42O5 — CID 142635460
[3,5-bis(phenylmethoxy)phenyl]-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]methanol (PubChem CID 142635460) has the molecular formula C44H42O5 and a molecular weight of 650.82 g/mol. Its IUPAC name is [3,5-bis(phenylmethoxy)phenyl]-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]methanol.
| Compound Name | [3,5-bis(phenylmethoxy)phenyl]-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 142635460 |
| Molecular Formula | C44H42O5 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | [3,5-bis(phenylmethoxy)phenyl]-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]methanol |
| SMILES | Cc1c(C)c(OCc2ccccc2)c(C(O)c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C44H42O5/c1-31-32(2)44(49-30-37-22-14-7-15-23-37)41(33(3)43(31)48-29-36-20-12-6-13-21-36)42(45)38-24-39(46-27-34-16-8-4-9-17-34)26-40(25-38)47-28-35-18-10-5-11-19-35/h4-26,42,45H,27-30H2,1-3H3 |
| InChIKey | ZWVQPJIBIBENKZ-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |