C36H34N4O6 — CID 142636000
[3-[2-[benzyl-[4-(4-nitrophenyl)butyl]amino]-2-oxoacetyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]carbamic acid (PubChem CID 142636000) has the molecular formula C36H34N4O6 and a molecular weight of 618.69 g/mol. Its IUPAC name is [3-[2-[benzyl-[4-(4-nitrophenyl)butyl]amino]-2-oxoacetyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]carbamic acid.
| Compound Name | [3-[2-[benzyl-[4-(4-nitrophenyl)butyl]amino]-2-oxoacetyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]carbamic acid |
|---|---|
| PubChem CID | 142636000 |
| Molecular Formula | C36H34N4O6 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | [3-[2-[benzyl-[4-(4-nitrophenyl)butyl]amino]-2-oxoacetyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]carbamic acid |
| SMILES | Cc1cc(C)cc(-c2[nH]c3ccc(NC(=O)O)cc3c2C(=O)C(=O)N(CCCCc2ccc([N+](=O)[O-])cc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C36H34N4O6/c1-23-18-24(2)20-27(19-23)33-32(30-21-28(37-36(43)44)13-16-31(30)38-33)34(41)35(42)39(22-26-9-4-3-5-10-26)17-7-6-8-25-11-14-29(15-12-25)40(45)46/h3-5,9-16,18-21,37-38H,6-8,17,22H2,1-2H3,(H,43,44) |
| InChIKey | RJMGJJSXRVFMGY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|