About fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate
fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate (PubChem CID 142637358) has the molecular formula C11H19FO5
and a molecular weight of 250.27 g/mol. Its IUPAC name is fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate.
Analyze fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate?
The IUPAC name of fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate (CID 142637358) is fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate.
What is the SMILES notation for fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate?
The canonical SMILES for fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate is COC1CC(C)(C(=O)OF)CC(OC)C1OC.
What is the InChIKey of fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate?
The InChIKey is XSBULPDEMUEMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO5/c1-11(10(13)17-12)5-7(14-2)9(16-4)8(6-11)15-3/h7-9H,5-6H2,1-4H3.
What are the key properties of fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate?
fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate has a molecular weight of 250.27 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3,4,5-trimethoxy-1-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 142637358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).