C13H22O7 — CID 23562285
dimethyl 4,5,6-trimethoxycyclohexane-1,3-dicarboxylate (PubChem CID 23562285) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is dimethyl 4,5,6-trimethoxycyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl 4,5,6-trimethoxycyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23562285 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | dimethyl 4,5,6-trimethoxycyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)C1CC(C(=O)OC)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C13H22O7/c1-16-9-7(12(14)19-4)6-8(13(15)20-5)10(17-2)11(9)18-3/h7-11H,6H2,1-5H3 |
| InChIKey | WOBNYCQHYOAXMC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |