C12H12FNO2S — CID 142639747
1-(4-fluorophenoxy)-3-(1,3-thiazol-4-yl)propan-2-ol (PubChem CID 142639747) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(4-fluorophenoxy)-3-(1,3-thiazol-4-yl)propan-2-ol.
| Compound Name | 1-(4-fluorophenoxy)-3-(1,3-thiazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 142639747 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-(4-fluorophenoxy)-3-(1,3-thiazol-4-yl)propan-2-ol |
| SMILES | OC(COc1ccc(F)cc1)Cc1cscn1 |
| InChI | InChI=1S/C12H12FNO2S/c13-9-1-3-12(4-2-9)16-6-11(15)5-10-7-17-8-14-10/h1-4,7-8,11,15H,5-6H2 |
| InChIKey | QKYWLCAZXMTFRN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |