C22H34N2O7S — CID 142640112
4-[[4-[(2S)-2-(butylsulfamoyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoyl]amino]butanoic acid (PubChem CID 142640112) has the molecular formula C22H34N2O7S and a molecular weight of 470.59 g/mol. Its IUPAC name is 4-[[4-[(2S)-2-(butylsulfamoyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoyl]amino]butanoic acid.
| Compound Name | 4-[[4-[(2S)-2-(butylsulfamoyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 142640112 |
| Molecular Formula | C22H34N2O7S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-[[4-[(2S)-2-(butylsulfamoyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoyl]amino]butanoic acid |
| SMILES | CCCCNS(=O)(=O)[C@@H](Cc1ccc(C(=O)NCCCC(=O)O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34N2O7S/c1-5-6-14-24-32(29,30)18(21(28)31-22(2,3)4)15-16-9-11-17(12-10-16)20(27)23-13-7-8-19(25)26/h9-12,18,24H,5-8,13-15H2,1-4H3,(H,23,27)(H,25,26)/t18-/m0/s1 |
| InChIKey | ZSHSHPNEQHYCCA-SFHVURJKSA-N |
| XLogP | 2.25 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|