About 1-azaspiro[4.5]dec-1-ene;hydrochloride
1-azaspiro[4.5]dec-1-ene;hydrochloride (PubChem CID 142640162) has the molecular formula C9H16ClN
and a molecular weight of 173.69 g/mol. Its IUPAC name is 1-azaspiro[4.5]dec-1-ene;hydrochloride.
Molecular Properties
| Compound Name | 1-azaspiro[4.5]dec-1-ene;hydrochloride |
| PubChem CID | 142640162 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 1-azaspiro[4.5]dec-1-ene;hydrochloride |
| SMILES | C1=NC2(CC1)CCCCC2.Cl |
| InChI | InChI=1S/C9H15N.ClH/c1-2-5-9(6-3-1)7-4-8-10-9;/h8H,1-7H2;1H |
| InChIKey | BAMFMSVVRFHPCG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azaspiro[4.5]dec-1-ene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[4.5]dec-1-ene;hydrochloride?
The IUPAC name of 1-azaspiro[4.5]dec-1-ene;hydrochloride (CID 142640162) is 1-azaspiro[4.5]dec-1-ene;hydrochloride.
What is the SMILES notation for 1-azaspiro[4.5]dec-1-ene;hydrochloride?
The canonical SMILES for 1-azaspiro[4.5]dec-1-ene;hydrochloride is C1=NC2(CC1)CCCCC2.Cl.
What is the InChIKey of 1-azaspiro[4.5]dec-1-ene;hydrochloride?
The InChIKey is BAMFMSVVRFHPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.ClH/c1-2-5-9(6-3-1)7-4-8-10-9;/h8H,1-7H2;1H.
What are the key properties of 1-azaspiro[4.5]dec-1-ene;hydrochloride?
1-azaspiro[4.5]dec-1-ene;hydrochloride has a molecular weight of 173.69 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[4.5]dec-1-ene;hydrochloride is sourced from PubChem (CID 142640162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).