C19H18ClFN2O4S — CID 142641276
2-methoxyethyl 4-(4-chloro-2-fluoroanilino)-7-methoxyquinoline-6-sulfinate (PubChem CID 142641276) has the molecular formula C19H18ClFN2O4S and a molecular weight of 424.88 g/mol. Its IUPAC name is 2-methoxyethyl 4-(4-chloro-2-fluoroanilino)-7-methoxyquinoline-6-sulfinate.
| Compound Name | 2-methoxyethyl 4-(4-chloro-2-fluoroanilino)-7-methoxyquinoline-6-sulfinate |
|---|---|
| PubChem CID | 142641276 |
| Molecular Formula | C19H18ClFN2O4S |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-methoxyethyl 4-(4-chloro-2-fluoroanilino)-7-methoxyquinoline-6-sulfinate |
| SMILES | COCCOS(=O)c1cc2c(Nc3ccc(Cl)cc3F)ccnc2cc1OC |
| InChI | InChI=1S/C19H18ClFN2O4S/c1-25-7-8-27-28(24)19-10-13-15(5-6-22-17(13)11-18(19)26-2)23-16-4-3-12(20)9-14(16)21/h3-6,9-11H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | ZLMSUGZKHKJQRJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|