2-bromo-5-hexoxybenzoyl chloride

C13H16BrClO2 — CID 142644449

IUPAC2-bromo-5-hexoxybenzoyl chloride
SMILESCCCCCCOc1ccc(Br)c(C(=O)Cl)c1
InChIInChI=1S/C13H16BrClO2/c1-2-3-4-5-8-17-10-6-7-12(14)11(9-10)13(15)16/h6-7,9H,2-5,8H2,1H3
InChIKeyJTAHXKDMQMGNNK-UHFFFAOYSA-N
MW319.63 g/mol
LogP4.79
Rot. Bonds7

About 2-bromo-5-hexoxybenzoyl chloride

2-bromo-5-hexoxybenzoyl chloride (PubChem CID 142644449) has the molecular formula C13H16BrClO2 and a molecular weight of 319.63 g/mol. Its IUPAC name is 2-bromo-5-hexoxybenzoyl chloride.

Molecular Properties

Compound Name2-bromo-5-hexoxybenzoyl chloride
PubChem CID142644449
Molecular FormulaC13H16BrClO2
Molecular Weight319.63 g/mol
Exact Mass318.00
IUPAC Name2-bromo-5-hexoxybenzoyl chloride
SMILESCCCCCCOc1ccc(Br)c(C(=O)Cl)c1
InChIInChI=1S/C13H16BrClO2/c1-2-3-4-5-8-17-10-6-7-12(14)11(9-10)13(15)16/h6-7,9H,2-5,8H2,1H3
InChIKeyJTAHXKDMQMGNNK-UHFFFAOYSA-N
XLogP4.79
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.63
LogP ≤ 54.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-bromo-5-hexoxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-5-hexoxybenzoyl chloride?
The IUPAC name of 2-bromo-5-hexoxybenzoyl chloride (CID 142644449) is 2-bromo-5-hexoxybenzoyl chloride.
What is the SMILES notation for 2-bromo-5-hexoxybenzoyl chloride?
The canonical SMILES for 2-bromo-5-hexoxybenzoyl chloride is CCCCCCOc1ccc(Br)c(C(=O)Cl)c1.
What is the InChIKey of 2-bromo-5-hexoxybenzoyl chloride?
The InChIKey is JTAHXKDMQMGNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrClO2/c1-2-3-4-5-8-17-10-6-7-12(14)11(9-10)13(15)16/h6-7,9H,2-5,8H2,1H3.
What are the key properties of 2-bromo-5-hexoxybenzoyl chloride?
2-bromo-5-hexoxybenzoyl chloride has a molecular weight of 319.63 g/mol, XLogP of 4.79, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-hexoxybenzoyl chloride is sourced from PubChem (CID 142644449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).