About 2-bromo-5-hexoxybenzoyl chloride
2-bromo-5-hexoxybenzoyl chloride (PubChem CID 142644449) has the molecular formula C13H16BrClO2
and a molecular weight of 319.63 g/mol. Its IUPAC name is 2-bromo-5-hexoxybenzoyl chloride.
Molecular Properties
| Compound Name | 2-bromo-5-hexoxybenzoyl chloride |
| PubChem CID | 142644449 |
| Molecular Formula | C13H16BrClO2 |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-bromo-5-hexoxybenzoyl chloride |
| SMILES | CCCCCCOc1ccc(Br)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C13H16BrClO2/c1-2-3-4-5-8-17-10-6-7-12(14)11(9-10)13(15)16/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | JTAHXKDMQMGNNK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-hexoxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-hexoxybenzoyl chloride?
The IUPAC name of 2-bromo-5-hexoxybenzoyl chloride (CID 142644449) is 2-bromo-5-hexoxybenzoyl chloride.
What is the SMILES notation for 2-bromo-5-hexoxybenzoyl chloride?
The canonical SMILES for 2-bromo-5-hexoxybenzoyl chloride is CCCCCCOc1ccc(Br)c(C(=O)Cl)c1.
What is the InChIKey of 2-bromo-5-hexoxybenzoyl chloride?
The InChIKey is JTAHXKDMQMGNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrClO2/c1-2-3-4-5-8-17-10-6-7-12(14)11(9-10)13(15)16/h6-7,9H,2-5,8H2,1H3.
What are the key properties of 2-bromo-5-hexoxybenzoyl chloride?
2-bromo-5-hexoxybenzoyl chloride has a molecular weight of 319.63 g/mol, XLogP of 4.79, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-hexoxybenzoyl chloride is sourced from PubChem (CID 142644449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).