C11H23NO8S — CID 142648969
2-amino-4-methylsulfanylbutanoic acid;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 142648969) has the molecular formula C11H23NO8S and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 142648969 |
| Molecular Formula | C11H23NO8S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CSCCC(N)C(=O)O.OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6.C5H11NO2S/c7-1-2-3(8)4(9)5(10)6(11)12-2;1-9-3-2-4(6)5(7)8/h2-11H,1H2;4H,2-3,6H2,1H3,(H,7,8)/t2-,3-,4+,5-,6+;/m1./s1 |
| InChIKey | ZISJPCFUTHKVKH-WNFIKIDCSA-N |
| XLogP | -3.07 |
| TPSA | 173.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |