C12H26N4O8 — CID 171784599
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 171784599) has the molecular formula C12H26N4O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 171784599 |
| Molecular Formula | C12H26N4O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14N4O2.C6H12O6/c7-4(5(11)12)2-1-3-10-6(8)9;7-1-2-3(8)4(9)5(10)6(11)12-2/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-11H,1H2/t4-;2-,3-,4+,5-,6?/m01/s1 |
| InChIKey | HRLLSTDRYODZPG-MXXQJTOGSA-N |
| XLogP | -4.77 |
| TPSA | 238.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -4.77 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|