C12H24N4O7 — CID 54463480
(2S)-5-(diaminomethylideneamino)-2-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pentanoic acid (PubChem CID 54463480) has the molecular formula C12H24N4O7 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54463480 |
| Molecular Formula | C12H24N4O7 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C12H24N4O7/c13-12(14)15-3-1-2-5(11(21)22)16-10-9(20)8(19)7(18)6(4-17)23-10/h5-10,16-20H,1-4H2,(H,21,22)(H4,13,14,15)/t5-,6+,7+,8-,9+,10?/m0/s1 |
| InChIKey | XDFUHMHLHJANRG-YELCUQAHSA-N |
| XLogP | -4.12 |
| TPSA | 203.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|