C9H18N2O6S — CID 175726634
(2R)-3-sulfanyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propanamide (PubChem CID 175726634) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is (2R)-3-sulfanyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propanamide.
| Compound Name | (2R)-3-sulfanyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 175726634 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2R)-3-sulfanyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propanamide |
| SMILES | NC(=O)[C@H](CS)N[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18N2O6S/c10-8(16)3(2-18)11-9-7(15)6(14)5(13)4(1-12)17-9/h3-7,9,11-15,18H,1-2H2,(H2,10,16)/t3-,4+,5-,6-,7+,9-/m0/s1 |
| InChIKey | VUWVWFDZDOEZHD-QTMLJZJBSA-N |
| XLogP | -3.84 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|