C22H25NO12 — CID 142650743
[(2R,3S,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(4-formylphenyl)carbamoyloxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 142650743) has the molecular formula C22H25NO12 and a molecular weight of 499.46 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(4-formylphenyl)carbamoyloxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(4-formylphenyl)carbamoyloxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 142650743 |
| Molecular Formula | C22H25NO12 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(4-formylphenyl)carbamoyloxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(OC(=O)Nc2ccc(C=O)cc2)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C22H25NO12/c1-11(25)30-10-17-18(31-12(2)26)19(32-13(3)27)20(33-14(4)28)21(34-17)35-22(29)23-16-7-5-15(9-24)6-8-16/h5-9,17-21H,10H2,1-4H3,(H,23,29)/t17-,18+,19+,20-,21?/m1/s1/i1D,2D,3D,4D |
| InChIKey | LWOKEGNRKQMYOV-KIPFYTNGSA-N |
| XLogP | 1.13 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|