C12H8N2O3 — CID 142651340
methyl 5-oxo-4H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 142651340) has the molecular formula C12H8N2O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is methyl 5-oxo-4H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | methyl 5-oxo-4H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 142651340 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | methyl 5-oxo-4H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC(=O)C1=CC2=C3C=CN=C3C(=O)CC2=N1 |
| InChI | InChI=1S/C12H8N2O3/c1-17-12(16)9-4-7-6-2-3-13-11(6)10(15)5-8(7)14-9/h2-4H,5H2,1H3 |
| InChIKey | OOJLNYHGISLBQF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |