C6H15NO11S2 — CID 142658372
deuterio-[(2R,3R,4S,5R)-1,3,4,5-tetrahydroxy-6-sulfooxyhexan-2-yl]sulfamic acid (PubChem CID 142658372) has the molecular formula C6H15NO11S2 and a molecular weight of 342.32 g/mol. Its IUPAC name is deuterio-[(2R,3R,4S,5R)-1,3,4,5-tetrahydroxy-6-sulfooxyhexan-2-yl]sulfamic acid.
| Compound Name | deuterio-[(2R,3R,4S,5R)-1,3,4,5-tetrahydroxy-6-sulfooxyhexan-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 142658372 |
| Molecular Formula | C6H15NO11S2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | deuterio-[(2R,3R,4S,5R)-1,3,4,5-tetrahydroxy-6-sulfooxyhexan-2-yl]sulfamic acid |
| SMILES | [2H]N([C@H](CO)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C6H15NO11S2/c8-1-3(7-19(12,13)14)5(10)6(11)4(9)2-18-20(15,16)17/h3-11H,1-2H2,(H,12,13,14)(H,15,16,17)/t3-,4-,5-,6-/m1/s1/i/hD |
| InChIKey | PQQLTSXKZNFJLL-UDSPDPSBSA-N |
| XLogP | -4.36 |
| TPSA | 210.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|