C6H10N2O8P2 — CID 142659423
[phosphonooxy-(pyridin-2-ylamino)methyl] dihydrogen phosphate (PubChem CID 142659423) has the molecular formula C6H10N2O8P2 and a molecular weight of 300.10 g/mol. Its IUPAC name is [phosphonooxy-(pyridin-2-ylamino)methyl] dihydrogen phosphate.
| Compound Name | [phosphonooxy-(pyridin-2-ylamino)methyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 142659423 |
| Molecular Formula | C6H10N2O8P2 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | [phosphonooxy-(pyridin-2-ylamino)methyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(Nc1ccccn1)OP(=O)(O)O |
| InChI | InChI=1S/C6H10N2O8P2/c9-17(10,11)15-6(16-18(12,13)14)8-5-3-1-2-4-7-5/h1-4,6H,(H,7,8)(H2,9,10,11)(H2,12,13,14) |
| InChIKey | OMRFCDIMUDIMOF-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|