C19H28 — CID 142663550
1-(3-methylbutyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 142663550) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-(3-methylbutyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 1-(3-methylbutyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 142663550 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-(3-methylbutyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | CC(C)CCC1CCCC2c3ccccc3CCC12 |
| InChI | InChI=1S/C19H28/c1-14(2)10-11-16-7-5-9-19-17-8-4-3-6-15(17)12-13-18(16)19/h3-4,6,8,14,16,18-19H,5,7,9-13H2,1-2H3 |
| InChIKey | HPXCFZLRQJYWLH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |