C19H24 — CID 11436683
(1R,4aR,10aR)-1-[(1E,3E)-penta-1,3-dienyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 11436683) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,4aR,10aR)-1-[(1E,3E)-penta-1,3-dienyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | (1R,4aR,10aR)-1-[(1E,3E)-penta-1,3-dienyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 11436683 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (1R,4aR,10aR)-1-[(1E,3E)-penta-1,3-dienyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | C/C=C/C=C/[C@H]1CCC[C@H]2c3ccccc3CC[C@H]12 |
| InChI | InChI=1S/C19H24/c1-2-3-4-8-15-10-7-12-19-17-11-6-5-9-16(17)13-14-18(15)19/h2-6,8-9,11,15,18-19H,7,10,12-14H2,1H3/b3-2+,8-4+/t15-,18+,19-/m0/s1 |
| InChIKey | HXQWMLHKEZUQLF-JLJMYCCLSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|