C25H24N2O4 — CID 142665166
2-[1-[3-(2,4-diethoxyphenyl)-2-pyridinyl]ethyl]isoindole-1,3-dione (PubChem CID 142665166) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[1-[3-(2,4-diethoxyphenyl)-2-pyridinyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-(2,4-diethoxyphenyl)-2-pyridinyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142665166 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[1-[3-(2,4-diethoxyphenyl)-2-pyridinyl]ethyl]isoindole-1,3-dione |
| SMILES | CCOc1ccc(-c2cccnc2C(C)N2C(=O)c3ccccc3C2=O)c(OCC)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-4-30-17-12-13-18(22(15-17)31-5-2)19-11-8-14-26-23(19)16(3)27-24(28)20-9-6-7-10-21(20)25(27)29/h6-16H,4-5H2,1-3H3 |
| InChIKey | HJFXIOYJTXNQCC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|