C20H17N5O3 — CID 171813881
2-[1-[3-(6-ethoxypyridazin-3-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 171813881) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[1-[3-(6-ethoxypyridazin-3-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-(6-ethoxypyridazin-3-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171813881 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[1-[3-(6-ethoxypyridazin-3-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | CCOc1ccc(-c2nccnc2C(C)N2C(=O)c3ccccc3C2=O)nn1 |
| InChI | InChI=1S/C20H17N5O3/c1-3-28-16-9-8-15(23-24-16)18-17(21-10-11-22-18)12(2)25-19(26)13-6-4-5-7-14(13)20(25)27/h4-12H,3H2,1-2H3 |
| InChIKey | SUHBRMRWBBFJKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|