C20H16N8O2 — CID 175870166
2-[(1R)-1-[3-[1-(1-methylpyrazol-3-yl)triazol-4-yl]pyrazin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 175870166) has the molecular formula C20H16N8O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-[(1R)-1-[3-[1-(1-methylpyrazol-3-yl)triazol-4-yl]pyrazin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-[3-[1-(1-methylpyrazol-3-yl)triazol-4-yl]pyrazin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175870166 |
| Molecular Formula | C20H16N8O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[(1R)-1-[3-[1-(1-methylpyrazol-3-yl)triazol-4-yl]pyrazin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | C[C@H](c1nccnc1-c1cn(-c2ccn(C)n2)nn1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N8O2/c1-12(28-19(29)13-5-3-4-6-14(13)20(28)30)17-18(22-9-8-21-17)15-11-27(25-23-15)16-7-10-26(2)24-16/h3-12H,1-2H3/t12-/m1/s1 |
| InChIKey | JIDNXGSGGHBRDI-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|