C18H12ClN5O2 — CID 166162262
2-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 166162262) has the molecular formula C18H12ClN5O2 and a molecular weight of 365.78 g/mol. Its IUPAC name is 2-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166162262 |
| Molecular Formula | C18H12ClN5O2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1nccnc1-c1cnc(Cl)cn1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12ClN5O2/c1-10(24-17(25)11-4-2-3-5-12(11)18(24)26)15-16(21-7-6-20-15)13-8-23-14(19)9-22-13/h2-10H,1H3 |
| InChIKey | TUPFSEOAMOXUFQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|