C19H13BrN2O2 — CID 67516756
2-[1-(4-bromoisoquinolin-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 67516756) has the molecular formula C19H13BrN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-[1-(4-bromoisoquinolin-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-(4-bromoisoquinolin-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67516756 |
| Molecular Formula | C19H13BrN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[1-(4-bromoisoquinolin-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | CC(c1ncc2ccccc2c1Br)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13BrN2O2/c1-11(17-16(20)13-7-3-2-6-12(13)10-21-17)22-18(23)14-8-4-5-9-15(14)19(22)24/h2-11H,1H3 |
| InChIKey | TXBYELYYXYEYRZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|