C17H14N6O2 — CID 162524184
2-[1-[3-(1-methyltriazol-4-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 162524184) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-[1-[3-(1-methyltriazol-4-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-(1-methyltriazol-4-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162524184 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[1-[3-(1-methyltriazol-4-yl)pyrazin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1nccnc1-c1cn(C)nn1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N6O2/c1-10(23-16(24)11-5-3-4-6-12(11)17(23)25)14-15(19-8-7-18-14)13-9-22(2)21-20-13/h3-10H,1-2H3 |
| InChIKey | GAYOARPQDCXKNK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|