C20H20Cl4O4 — CID 142670951
2,4-dichloro-5-[(2,4-dichlorophenyl)methoxymethyl]-3-methyl-2-phenylmethoxyoxolan-3-ol (PubChem CID 142670951) has the molecular formula C20H20Cl4O4 and a molecular weight of 466.19 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2,4-dichlorophenyl)methoxymethyl]-3-methyl-2-phenylmethoxyoxolan-3-ol.
| Compound Name | 2,4-dichloro-5-[(2,4-dichlorophenyl)methoxymethyl]-3-methyl-2-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 142670951 |
| Molecular Formula | C20H20Cl4O4 |
| Molecular Weight | 466.19 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | 2,4-dichloro-5-[(2,4-dichlorophenyl)methoxymethyl]-3-methyl-2-phenylmethoxyoxolan-3-ol |
| SMILES | CC1(O)C(Cl)C(COCc2ccc(Cl)cc2Cl)OC1(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C20H20Cl4O4/c1-19(25)18(23)17(12-26-11-14-7-8-15(21)9-16(14)22)28-20(19,24)27-10-13-5-3-2-4-6-13/h2-9,17-18,25H,10-12H2,1H3 |
| InChIKey | AYEPWMGMLZQNEH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|