C27H22Cl6N2O4 — CID 135061798
(3R,4R,5R)-4-[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]-2-(4,6-dichloropyrrolo[3,2-c]pyridin-1-yl)-3-methyloxolan-3-ol (PubChem CID 135061798) has the molecular formula C27H22Cl6N2O4 and a molecular weight of 651.20 g/mol. Its IUPAC name is (3R,4R,5R)-4-[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]-2-(4,6-dichloropyrrolo[3,2-c]pyridin-1-yl)-3-methyloxolan-3-ol.
| Compound Name | (3R,4R,5R)-4-[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]-2-(4,6-dichloropyrrolo[3,2-c]pyridin-1-yl)-3-methyloxolan-3-ol |
|---|---|
| PubChem CID | 135061798 |
| Molecular Formula | C27H22Cl6N2O4 |
| Molecular Weight | 651.20 g/mol |
| Exact Mass | 647.97 |
| IUPAC Name | (3R,4R,5R)-4-[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]-2-(4,6-dichloropyrrolo[3,2-c]pyridin-1-yl)-3-methyloxolan-3-ol |
| SMILES | C[C@]1(O)C(n2ccc3c(Cl)nc(Cl)cc32)O[C@H](COCc2ccc(Cl)cc2Cl)[C@H]1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H22Cl6N2O4/c1-27(36)24(38-12-15-3-5-17(29)9-20(15)31)22(13-37-11-14-2-4-16(28)8-19(14)30)39-26(27)35-7-6-18-21(35)10-23(32)34-25(18)33/h2-10,22,24,26,36H,11-13H2,1H3/t22-,24-,26?,27-/m1/s1 |
| InChIKey | UNRJWXZCLNRRPD-OLKWLZBGSA-N |
| XLogP | 8.41 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.20 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|