C12H9NO5 — CID 142672632
2-[(3,4-dioxonaphthalen-1-yl)amino]oxyacetic acid (PubChem CID 142672632) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-[(3,4-dioxonaphthalen-1-yl)amino]oxyacetic acid.
| Compound Name | 2-[(3,4-dioxonaphthalen-1-yl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 142672632 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[(3,4-dioxonaphthalen-1-yl)amino]oxyacetic acid |
| SMILES | O=C(O)CONC1=CC(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H9NO5/c14-10-5-9(13-18-6-11(15)16)7-3-1-2-4-8(7)12(10)17/h1-5,13H,6H2,(H,15,16) |
| InChIKey | FGRPVBHDGGLIND-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|