About benzo[g][1,2,3]benzodioxazole-3-carboxamide
benzo[g][1,2,3]benzodioxazole-3-carboxamide (PubChem CID 142673238) has the molecular formula C11H8N2O3
and a molecular weight of 216.20 g/mol. Its IUPAC name is benzo[g][1,2,3]benzodioxazole-3-carboxamide.
Molecular Properties
| Compound Name | benzo[g][1,2,3]benzodioxazole-3-carboxamide |
| PubChem CID | 142673238 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | benzo[g][1,2,3]benzodioxazole-3-carboxamide |
| SMILES | NC(=O)N1OOc2c1ccc1ccccc21 |
| InChI | InChI=1S/C11H8N2O3/c12-11(14)13-9-6-5-7-3-1-2-4-8(7)10(9)15-16-13/h1-6H,(H2,12,14) |
| InChIKey | IZHOZVFMUATAGR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzo[g][1,2,3]benzodioxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g][1,2,3]benzodioxazole-3-carboxamide?
The IUPAC name of benzo[g][1,2,3]benzodioxazole-3-carboxamide (CID 142673238) is benzo[g][1,2,3]benzodioxazole-3-carboxamide.
What is the SMILES notation for benzo[g][1,2,3]benzodioxazole-3-carboxamide?
The canonical SMILES for benzo[g][1,2,3]benzodioxazole-3-carboxamide is NC(=O)N1OOc2c1ccc1ccccc21.
What is the InChIKey of benzo[g][1,2,3]benzodioxazole-3-carboxamide?
The InChIKey is IZHOZVFMUATAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3/c12-11(14)13-9-6-5-7-3-1-2-4-8(7)10(9)15-16-13/h1-6H,(H2,12,14).
What are the key properties of benzo[g][1,2,3]benzodioxazole-3-carboxamide?
benzo[g][1,2,3]benzodioxazole-3-carboxamide has a molecular weight of 216.20 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g][1,2,3]benzodioxazole-3-carboxamide is sourced from PubChem (CID 142673238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).