C11H8N2O3 — CID 142673238
benzo[g][1,2,3]benzodioxazole-3-carboxamide (PubChem CID 142673238) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is benzo[g][1,2,3]benzodioxazole-3-carboxamide.
| Compound Name | benzo[g][1,2,3]benzodioxazole-3-carboxamide |
|---|---|
| PubChem CID | 142673238 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | benzo[g][1,2,3]benzodioxazole-3-carboxamide |
| SMILES | NC(=O)N1OOc2c1ccc1ccccc21 |
| InChI | InChI=1S/C11H8N2O3/c12-11(14)13-9-6-5-7-3-1-2-4-8(7)10(9)15-16-13/h1-6H,(H2,12,14) |
| InChIKey | IZHOZVFMUATAGR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|