C23H15AlF6N2O4S2 — CID 16689015
13-methyl-12,14-bis(trifluoromethylsulfonyl)-12,14-diaza-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 16689015) has the molecular formula C23H15AlF6N2O4S2 and a molecular weight of 588.49 g/mol. Its IUPAC name is 13-methyl-12,14-bis(trifluoromethylsulfonyl)-12,14-diaza-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-methyl-12,14-bis(trifluoromethylsulfonyl)-12,14-diaza-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 16689015 |
| Molecular Formula | C23H15AlF6N2O4S2 |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | 13-methyl-12,14-bis(trifluoromethylsulfonyl)-12,14-diaza-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | C[Al]1N(S(=O)(=O)C(F)(F)F)c2ccc3ccccc3c2-c2c(ccc3ccccc23)N1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H12F6N2O4S2.CH3.Al/c23-21(24,25)35(31,32)29-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)30-36(33,34)22(26,27)28;;/h1-12H;1H3;/q-2;;+2 |
| InChIKey | ROXCIULHXYWKNY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |