C22H12F6Hg2O6S2 — CID 16689642
trifluoromethylsulfonyloxy-[1-[2-(trifluoromethylsulfonyloxymercurio)naphthalen-1-yl]naphthalen-2-yl]mercury (PubChem CID 16689642) has the molecular formula C22H12F6Hg2O6S2 and a molecular weight of 951.63 g/mol. Its IUPAC name is trifluoromethylsulfonyloxy-[1-[2-(trifluoromethylsulfonyloxymercurio)naphthalen-1-yl]naphthalen-2-yl]mercury.
| Compound Name | trifluoromethylsulfonyloxy-[1-[2-(trifluoromethylsulfonyloxymercurio)naphthalen-1-yl]naphthalen-2-yl]mercury |
|---|---|
| PubChem CID | 16689642 |
| Molecular Formula | C22H12F6Hg2O6S2 |
| Molecular Weight | 951.63 g/mol |
| Exact Mass | 953.94 |
| IUPAC Name | trifluoromethylsulfonyloxy-[1-[2-(trifluoromethylsulfonyloxymercurio)naphthalen-1-yl]naphthalen-2-yl]mercury |
| SMILES | O=S(=O)(O[Hg]c1ccc2ccccc2c1-c1c([Hg]OS(=O)(=O)C(F)(F)F)ccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C20H12.2CHF3O3S.2Hg/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;2*2-1(3,4)8(5,6)7;;/h1-12H;2*(H,5,6,7);;/q;;;2*+1/p-2 |
| InChIKey | ZWUPXQBAACYZJI-UHFFFAOYSA-L |
| XLogP | 4.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|