C27H27N3O2 — CID 142674410
2-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)hexan-2-yloxy]phenol (PubChem CID 142674410) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)hexan-2-yloxy]phenol.
| Compound Name | 2-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)hexan-2-yloxy]phenol |
|---|---|
| PubChem CID | 142674410 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)hexan-2-yloxy]phenol |
| SMILES | CCCCC(Cc1nc(-c2ccccc2)nc(-c2ccccc2)n1)Oc1ccccc1O |
| InChI | InChI=1S/C27H27N3O2/c1-2-3-16-22(32-24-18-11-10-17-23(24)31)19-25-28-26(20-12-6-4-7-13-20)30-27(29-25)21-14-8-5-9-15-21/h4-15,17-18,22,31H,2-3,16,19H2,1H3 |
| InChIKey | AOYKFMAQOMWQAX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |