C29H24N2OP2 — CID 142677779
4,5-bis(diphenylphosphanylmethylidene)imidazolidin-2-one (PubChem CID 142677779) has the molecular formula C29H24N2OP2 and a molecular weight of 478.47 g/mol. Its IUPAC name is 4,5-bis(diphenylphosphanylmethylidene)imidazolidin-2-one.
| Compound Name | 4,5-bis(diphenylphosphanylmethylidene)imidazolidin-2-one |
|---|---|
| PubChem CID | 142677779 |
| Molecular Formula | C29H24N2OP2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4,5-bis(diphenylphosphanylmethylidene)imidazolidin-2-one |
| SMILES | O=c1[nH]c(=CP(c2ccccc2)c2ccccc2)c(=CP(c2ccccc2)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C29H24N2OP2/c32-29-30-27(21-33(23-13-5-1-6-14-23)24-15-7-2-8-16-24)28(31-29)22-34(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22H,(H2,30,31,32) |
| InChIKey | LNSQPKUPKWJEOA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|